C20H26N4O2S — CID 143370535
3-N-(1H-indazol-5-yl)-1-N-(4-methylsulfonylphenyl)hexane-1,3-diamine (PubChem CID 143370535) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 3-N-(1H-indazol-5-yl)-1-N-(4-methylsulfonylphenyl)hexane-1,3-diamine.
| Compound Name | 3-N-(1H-indazol-5-yl)-1-N-(4-methylsulfonylphenyl)hexane-1,3-diamine |
|---|---|
| PubChem CID | 143370535 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 3-N-(1H-indazol-5-yl)-1-N-(4-methylsulfonylphenyl)hexane-1,3-diamine |
| SMILES | CCCC(CCNc1ccc(S(C)(=O)=O)cc1)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C20H26N4O2S/c1-3-4-17(23-18-7-10-20-15(13-18)14-22-24-20)11-12-21-16-5-8-19(9-6-16)27(2,25)26/h5-10,13-14,17,21,23H,3-4,11-12H2,1-2H3,(H,22,24) |
| InChIKey | XGMRSUUETUPLKL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |