C34H44Cl2S4 — CID 132551013
2,3-bis(5-chloro-4-hexylthiophen-2-yl)-5-(3-hexylthiophen-2-yl)thiophene (PubChem CID 132551013) has the molecular formula C34H44Cl2S4 and a molecular weight of 651.90 g/mol. Its IUPAC name is 2,3-bis(5-chloro-4-hexylthiophen-2-yl)-5-(3-hexylthiophen-2-yl)thiophene.
| Compound Name | 2,3-bis(5-chloro-4-hexylthiophen-2-yl)-5-(3-hexylthiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 132551013 |
| Molecular Formula | C34H44Cl2S4 |
| Molecular Weight | 651.90 g/mol |
| Exact Mass | 650.17 |
| IUPAC Name | 2,3-bis(5-chloro-4-hexylthiophen-2-yl)-5-(3-hexylthiophen-2-yl)thiophene |
| SMILES | CCCCCCc1cc(-c2cc(-c3sccc3CCCCCC)sc2-c2cc(CCCCCC)c(Cl)s2)sc1Cl |
| InChI | InChI=1S/C34H44Cl2S4/c1-4-7-10-13-16-24-19-20-37-31(24)30-23-27(28-21-25(33(35)39-28)17-14-11-8-5-2)32(38-30)29-22-26(34(36)40-29)18-15-12-9-6-3/h19-23H,4-18H2,1-3H3 |
| InChIKey | ODIQNUFZJJIYFE-UHFFFAOYSA-N |
| XLogP | 14.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.90 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|