C12H20BrClO2 — CID 132551744
[(E,6R)-6-bromo-7-chloro-3,7-dimethyloct-2-enyl] acetate (PubChem CID 132551744) has the molecular formula C12H20BrClO2 and a molecular weight of 311.65 g/mol. Its IUPAC name is [(E,6R)-6-bromo-7-chloro-3,7-dimethyloct-2-enyl] acetate.
| Compound Name | [(E,6R)-6-bromo-7-chloro-3,7-dimethyloct-2-enyl] acetate |
|---|---|
| PubChem CID | 132551744 |
| Molecular Formula | C12H20BrClO2 |
| Molecular Weight | 311.65 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | [(E,6R)-6-bromo-7-chloro-3,7-dimethyloct-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC[C@@H](Br)C(C)(C)Cl |
| InChI | InChI=1S/C12H20BrClO2/c1-9(7-8-16-10(2)15)5-6-11(13)12(3,4)14/h7,11H,5-6,8H2,1-4H3/b9-7+/t11-/m1/s1 |
| InChIKey | PQUMNODEYJGRGC-MXMFLMJRSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|