C12H20BrClO3 — CID 134959522
[(E,6R,7S)-6-bromo-7-chloro-8-hydroxy-3,7-dimethyloct-2-enyl] acetate (PubChem CID 134959522) has the molecular formula C12H20BrClO3 and a molecular weight of 327.65 g/mol. Its IUPAC name is [(E,6R,7S)-6-bromo-7-chloro-8-hydroxy-3,7-dimethyloct-2-enyl] acetate.
| Compound Name | [(E,6R,7S)-6-bromo-7-chloro-8-hydroxy-3,7-dimethyloct-2-enyl] acetate |
|---|---|
| PubChem CID | 134959522 |
| Molecular Formula | C12H20BrClO3 |
| Molecular Weight | 327.65 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | [(E,6R,7S)-6-bromo-7-chloro-8-hydroxy-3,7-dimethyloct-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC[C@@H](Br)[C@@](C)(Cl)CO |
| InChI | InChI=1S/C12H20BrClO3/c1-9(6-7-17-10(2)16)4-5-11(13)12(3,14)8-15/h6,11,15H,4-5,7-8H2,1-3H3/b9-6+/t11-,12+/m1/s1 |
| InChIKey | UAZCSVCQKGWGIG-FIRGKKCLSA-N |
| XLogP | 3.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|