C12H18BrClO3 — CID 101410308
[(1R,5S)-5-bromo-2-[(1R)-2-chloro-1-hydroxyethyl]-4,4-dimethylcyclohex-2-en-1-yl] acetate (PubChem CID 101410308) has the molecular formula C12H18BrClO3 and a molecular weight of 325.63 g/mol. Its IUPAC name is [(1R,5S)-5-bromo-2-[(1R)-2-chloro-1-hydroxyethyl]-4,4-dimethylcyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,5S)-5-bromo-2-[(1R)-2-chloro-1-hydroxyethyl]-4,4-dimethylcyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 101410308 |
| Molecular Formula | C12H18BrClO3 |
| Molecular Weight | 325.63 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | [(1R,5S)-5-bromo-2-[(1R)-2-chloro-1-hydroxyethyl]-4,4-dimethylcyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](Br)C(C)(C)C=C1[C@@H](O)CCl |
| InChI | InChI=1S/C12H18BrClO3/c1-7(15)17-10-4-11(13)12(2,3)5-8(10)9(16)6-14/h5,9-11,16H,4,6H2,1-3H3/t9-,10+,11-/m0/s1 |
| InChIKey | BHXAZJOOTJJKIV-AXFHLTTASA-N |
| XLogP | 2.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.63 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|