C10H16BrClO2 — CID 74051296
5-bromo-2-(2-chloro-1-hydroxyethyl)-4,4-dimethylcyclohex-2-en-1-ol (PubChem CID 74051296) has the molecular formula C10H16BrClO2 and a molecular weight of 283.59 g/mol. Its IUPAC name is 5-bromo-2-(2-chloro-1-hydroxyethyl)-4,4-dimethylcyclohex-2-en-1-ol.
| Compound Name | 5-bromo-2-(2-chloro-1-hydroxyethyl)-4,4-dimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 74051296 |
| Molecular Formula | C10H16BrClO2 |
| Molecular Weight | 283.59 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 5-bromo-2-(2-chloro-1-hydroxyethyl)-4,4-dimethylcyclohex-2-en-1-ol |
| SMILES | CC1(C)C=C(C(O)CCl)C(O)CC1Br |
| InChI | InChI=1S/C10H16BrClO2/c1-10(2)4-6(8(14)5-12)7(13)3-9(10)11/h4,7-9,13-14H,3,5H2,1-2H3 |
| InChIKey | WNVHLTPVXGNQOI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.59 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|