C10H15Br2ClO — CID 162933889
(1S,5R)-5-bromo-2-[(1S)-2-bromo-1-chloroethyl]-4,4-dimethylcyclohex-2-en-1-ol (PubChem CID 162933889) has the molecular formula C10H15Br2ClO and a molecular weight of 346.49 g/mol. Its IUPAC name is (1S,5R)-5-bromo-2-[(1S)-2-bromo-1-chloroethyl]-4,4-dimethylcyclohex-2-en-1-ol.
| Compound Name | (1S,5R)-5-bromo-2-[(1S)-2-bromo-1-chloroethyl]-4,4-dimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 162933889 |
| Molecular Formula | C10H15Br2ClO |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 343.92 |
| IUPAC Name | (1S,5R)-5-bromo-2-[(1S)-2-bromo-1-chloroethyl]-4,4-dimethylcyclohex-2-en-1-ol |
| SMILES | CC1(C)C=C([C@H](Cl)CBr)[C@@H](O)C[C@H]1Br |
| InChI | InChI=1S/C10H15Br2ClO/c1-10(2)4-6(7(13)5-11)8(14)3-9(10)12/h4,7-9,14H,3,5H2,1-2H3/t7-,8+,9-/m1/s1 |
| InChIKey | LDCWMHKUXSPDGS-HRDYMLBCSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|