C15H22BrClO — CID 163194378
(3S,4S,6R)-4-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol (PubChem CID 163194378) has the molecular formula C15H22BrClO and a molecular weight of 333.70 g/mol. Its IUPAC name is (3S,4S,6R)-4-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol.
| Compound Name | (3S,4S,6R)-4-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol |
|---|---|
| PubChem CID | 163194378 |
| Molecular Formula | C15H22BrClO |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | (3S,4S,6R)-4-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol |
| SMILES | CC1=C[C@H](O)[C@@H](Br)C(C)(C)[C@@]12CCC(C)=C(Cl)C2 |
| InChI | InChI=1S/C15H22BrClO/c1-9-5-6-15(8-11(9)17)10(2)7-12(18)13(16)14(15,3)4/h7,12-13,18H,5-6,8H2,1-4H3/t12-,13+,15+/m0/s1 |
| InChIKey | PALDMPFKGDXAOX-GZBFAFLISA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|