C12H21ClO3 — CID 10988656
[(E)-7-chloro-6-hydroxy-3,7-dimethyloct-2-enyl] acetate (PubChem CID 10988656) has the molecular formula C12H21ClO3 and a molecular weight of 248.75 g/mol. Its IUPAC name is [(E)-7-chloro-6-hydroxy-3,7-dimethyloct-2-enyl] acetate.
| Compound Name | [(E)-7-chloro-6-hydroxy-3,7-dimethyloct-2-enyl] acetate |
|---|---|
| PubChem CID | 10988656 |
| Molecular Formula | C12H21ClO3 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [(E)-7-chloro-6-hydroxy-3,7-dimethyloct-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CCC(O)C(C)(C)Cl |
| InChI | InChI=1S/C12H21ClO3/c1-9(7-8-16-10(2)14)5-6-11(15)12(3,4)13/h7,11,15H,5-6,8H2,1-4H3/b9-7+ |
| InChIKey | YMFVPPDDWUZPBL-VQHVLOKHSA-N |
| XLogP | 2.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|