C22H35ClO3 — CID 71508825
[(1E,4S,7E,11R,12R)-11-chloro-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7-dien-1-yl]methyl acetate (PubChem CID 71508825) has the molecular formula C22H35ClO3 and a molecular weight of 382.97 g/mol. Its IUPAC name is [(1E,4S,7E,11R,12R)-11-chloro-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7-dien-1-yl]methyl acetate.
| Compound Name | [(1E,4S,7E,11R,12R)-11-chloro-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7-dien-1-yl]methyl acetate |
|---|---|
| PubChem CID | 71508825 |
| Molecular Formula | C22H35ClO3 |
| Molecular Weight | 382.97 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | [(1E,4S,7E,11R,12R)-11-chloro-12-hydroxy-7,11-dimethyl-4-prop-1-en-2-ylcyclotetradeca-1,7-dien-1-yl]methyl acetate |
| SMILES | C=C(C)[C@@H]1C/C=C(/COC(C)=O)CC[C@@H](O)[C@](C)(Cl)CC/C=C(\C)CC1 |
| InChI | InChI=1S/C22H35ClO3/c1-16(2)20-11-8-17(3)7-6-14-22(5,23)21(25)13-10-19(9-12-20)15-26-18(4)24/h7,9,20-21,25H,1,6,8,10-15H2,2-5H3/b17-7+,19-9+/t20-,21+,22+/m0/s1 |
| InChIKey | PJOBIWGTOLOXCA-ZRWNGRASSA-N |
| XLogP | 5.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.97 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|