C39H37NO6S — CID 132552586
[(2R,3R,4S,5R,6S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-3-yl] pyridine-2-carboxylate (PubChem CID 132552586) has the molecular formula C39H37NO6S and a molecular weight of 647.79 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-3-yl] pyridine-2-carboxylate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-3-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 132552586 |
| Molecular Formula | C39H37NO6S |
| Molecular Weight | 647.79 g/mol |
| Exact Mass | 647.23 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-3-yl] pyridine-2-carboxylate |
| SMILES | O=C(O[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](Sc2ccccc2)O[C@@H]1COCc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C39H37NO6S/c41-38(33-23-13-14-24-40-33)46-35-34(28-42-25-29-15-5-1-6-16-29)45-39(47-32-21-11-4-12-22-32)37(44-27-31-19-9-3-10-20-31)36(35)43-26-30-17-7-2-8-18-30/h1-24,34-37,39H,25-28H2/t34-,35-,36+,37-,39+/m1/s1 |
| InChIKey | YTJLCJXZRBILOD-FVGDZVOTSA-N |
| XLogP | 7.51 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.79 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |