C22H22N2O2S — CID 132553338
(2R)-2-(4-methylphenyl)-1-methylsulfonyl-4-phenyl-2,3-dihydroquinoxaline (PubChem CID 132553338) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is (2R)-2-(4-methylphenyl)-1-methylsulfonyl-4-phenyl-2,3-dihydroquinoxaline.
| Compound Name | (2R)-2-(4-methylphenyl)-1-methylsulfonyl-4-phenyl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 132553338 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (2R)-2-(4-methylphenyl)-1-methylsulfonyl-4-phenyl-2,3-dihydroquinoxaline |
| SMILES | Cc1ccc([C@@H]2CN(c3ccccc3)c3ccccc3N2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H22N2O2S/c1-17-12-14-18(15-13-17)22-16-23(19-8-4-3-5-9-19)20-10-6-7-11-21(20)24(22)27(2,25)26/h3-15,22H,16H2,1-2H3/t22-/m0/s1 |
| InChIKey | RPBGOHRCMCBAQJ-QFIPXVFZSA-N |
| XLogP | 4.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |