C16H14N2O4S2 — CID 132555313
4-hydroxy-3-[(4-methoxyphenyl)methyl]-6-nitro-4H-1,3-benzothiazine-2-thione (PubChem CID 132555313) has the molecular formula C16H14N2O4S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-methoxyphenyl)methyl]-6-nitro-4H-1,3-benzothiazine-2-thione.
| Compound Name | 4-hydroxy-3-[(4-methoxyphenyl)methyl]-6-nitro-4H-1,3-benzothiazine-2-thione |
|---|---|
| PubChem CID | 132555313 |
| Molecular Formula | C16H14N2O4S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 4-hydroxy-3-[(4-methoxyphenyl)methyl]-6-nitro-4H-1,3-benzothiazine-2-thione |
| SMILES | COc1ccc(CN2C(=S)Sc3ccc([N+](=O)[O-])cc3C2O)cc1 |
| InChI | InChI=1S/C16H14N2O4S2/c1-22-12-5-2-10(3-6-12)9-17-15(19)13-8-11(18(20)21)4-7-14(13)24-16(17)23/h2-8,15,19H,9H2,1H3 |
| InChIKey | GFEDXNFZDRFKQL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|