C48H81NO2Si — CID 132556017
4-[2-[4-ethynyl-2,5-bis(2-hexyldecoxy)phenyl]ethynyl-dimethylsilyl]butanenitrile (PubChem CID 132556017) has the molecular formula C48H81NO2Si and a molecular weight of 732.27 g/mol. Its IUPAC name is 4-[2-[4-ethynyl-2,5-bis(2-hexyldecoxy)phenyl]ethynyl-dimethylsilyl]butanenitrile.
| Compound Name | 4-[2-[4-ethynyl-2,5-bis(2-hexyldecoxy)phenyl]ethynyl-dimethylsilyl]butanenitrile |
|---|---|
| PubChem CID | 132556017 |
| Molecular Formula | C48H81NO2Si |
| Molecular Weight | 732.27 g/mol |
| Exact Mass | 731.60 |
| IUPAC Name | 4-[2-[4-ethynyl-2,5-bis(2-hexyldecoxy)phenyl]ethynyl-dimethylsilyl]butanenitrile |
| SMILES | C#Cc1cc(OCC(CCCCCC)CCCCCCCC)c(C#C[Si](C)(C)CCCC#N)cc1OCC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C48H81NO2Si/c1-8-13-17-21-23-27-33-43(31-25-19-15-10-3)41-50-47-40-46(35-38-52(6,7)37-30-29-36-49)48(39-45(47)12-5)51-42-44(32-26-20-16-11-4)34-28-24-22-18-14-9-2/h5,39-40,43-44H,8-11,13-34,37,41-42H2,1-4,6-7H3 |
| InChIKey | TUUXTTWUVHRLCP-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.27 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|