About 1-cyclohexyl-3,3-diphenylpropan-1-one
1-cyclohexyl-3,3-diphenylpropan-1-one (PubChem CID 132557223) has the molecular formula C21H24O
and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-cyclohexyl-3,3-diphenylpropan-1-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-3,3-diphenylpropan-1-one |
| PubChem CID | 132557223 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-cyclohexyl-3,3-diphenylpropan-1-one |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H24O/c22-21(19-14-8-3-9-15-19)16-20(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-2,4-7,10-13,19-20H,3,8-9,14-16H2 |
| InChIKey | YVPIMNDRMCCVGE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-3,3-diphenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3,3-diphenylpropan-1-one?
The IUPAC name of 1-cyclohexyl-3,3-diphenylpropan-1-one (CID 132557223) is 1-cyclohexyl-3,3-diphenylpropan-1-one.
What is the SMILES notation for 1-cyclohexyl-3,3-diphenylpropan-1-one?
The canonical SMILES for 1-cyclohexyl-3,3-diphenylpropan-1-one is O=C(CC(c1ccccc1)c1ccccc1)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3,3-diphenylpropan-1-one?
The InChIKey is YVPIMNDRMCCVGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O/c22-21(19-14-8-3-9-15-19)16-20(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-2,4-7,10-13,19-20H,3,8-9,14-16H2.
What are the key properties of 1-cyclohexyl-3,3-diphenylpropan-1-one?
1-cyclohexyl-3,3-diphenylpropan-1-one has a molecular weight of 292.42 g/mol, XLogP of 5.36, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3,3-diphenylpropan-1-one is sourced from PubChem (CID 132557223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).