C19H24O6 — CID 132557275
2-(3-benzyl-2,4-dioxopentan-3-yl)oxycarbonyl-2-ethylbutanoic acid (PubChem CID 132557275) has the molecular formula C19H24O6 and a molecular weight of 348.39 g/mol. Its IUPAC name is 2-(3-benzyl-2,4-dioxopentan-3-yl)oxycarbonyl-2-ethylbutanoic acid.
| Compound Name | 2-(3-benzyl-2,4-dioxopentan-3-yl)oxycarbonyl-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 132557275 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-(3-benzyl-2,4-dioxopentan-3-yl)oxycarbonyl-2-ethylbutanoic acid |
| SMILES | CCC(CC)(C(=O)O)C(=O)OC(Cc1ccccc1)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C19H24O6/c1-5-18(6-2,16(22)23)17(24)25-19(13(3)20,14(4)21)12-15-10-8-7-9-11-15/h7-11H,5-6,12H2,1-4H3,(H,22,23) |
| InChIKey | ZTFCAFQXHVJNEM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|