C24H26O6 — CID 132558672
5-[(2-methoxyphenyl)methyl]-2,2-dimethyl-5-[(2S)-2-methyl-3-oxo-3-phenylpropyl]-1,3-dioxane-4,6-dione (PubChem CID 132558672) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is 5-[(2-methoxyphenyl)methyl]-2,2-dimethyl-5-[(2S)-2-methyl-3-oxo-3-phenylpropyl]-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2-methoxyphenyl)methyl]-2,2-dimethyl-5-[(2S)-2-methyl-3-oxo-3-phenylpropyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 132558672 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 5-[(2-methoxyphenyl)methyl]-2,2-dimethyl-5-[(2S)-2-methyl-3-oxo-3-phenylpropyl]-1,3-dioxane-4,6-dione |
| SMILES | COc1ccccc1CC1(C[C@H](C)C(=O)c2ccccc2)C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C24H26O6/c1-16(20(25)17-10-6-5-7-11-17)14-24(15-18-12-8-9-13-19(18)28-4)21(26)29-23(2,3)30-22(24)27/h5-13,16H,14-15H2,1-4H3/t16-/m0/s1 |
| InChIKey | DGPQQSALWILNNB-INIZCTEOSA-N |
| XLogP | 3.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|