C20H23F3O5 — CID 132558750
dipropan-2-yl 2-oxo-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pentanedioate (PubChem CID 132558750) has the molecular formula C20H23F3O5 and a molecular weight of 400.39 g/mol. Its IUPAC name is dipropan-2-yl 2-oxo-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pentanedioate.
| Compound Name | dipropan-2-yl 2-oxo-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pentanedioate |
|---|---|
| PubChem CID | 132558750 |
| Molecular Formula | C20H23F3O5 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | dipropan-2-yl 2-oxo-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]pentanedioate |
| SMILES | CC(C)OC(=O)C(=O)CC(/C=C/c1ccc(C(F)(F)F)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C20H23F3O5/c1-12(2)27-18(25)15(11-17(24)19(26)28-13(3)4)8-5-14-6-9-16(10-7-14)20(21,22)23/h5-10,12-13,15H,11H2,1-4H3/b8-5+ |
| InChIKey | VHJDPZSTXNKRMF-VMPITWQZSA-N |
| XLogP | 4.20 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|