C18H14Cl2S — CID 132562054
2-(3,4-dichlorophenyl)-4-(3,5-dimethylphenyl)thiophene (PubChem CID 132562054) has the molecular formula C18H14Cl2S and a molecular weight of 333.28 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-(3,5-dimethylphenyl)thiophene.
| Compound Name | 2-(3,4-dichlorophenyl)-4-(3,5-dimethylphenyl)thiophene |
|---|---|
| PubChem CID | 132562054 |
| Molecular Formula | C18H14Cl2S |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-(3,5-dimethylphenyl)thiophene |
| SMILES | Cc1cc(C)cc(-c2csc(-c3ccc(Cl)c(Cl)c3)c2)c1 |
| InChI | InChI=1S/C18H14Cl2S/c1-11-5-12(2)7-14(6-11)15-9-18(21-10-15)13-3-4-16(19)17(20)8-13/h3-10H,1-2H3 |
| InChIKey | CXRNQAIPMZFNFN-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |