C36H36BrClN4O8S — CID 132563040
tert-butyl (2S,4S)-2-[[(1S)-2-(4-bromophenyl)-1-[(4-chloro-3-nitrophenyl)sulfonylamino]ethyl]carbamoyl]-4-(4-phenylphenoxy)pyrrolidine-1-carboxylate (PubChem CID 132563040) has the molecular formula C36H36BrClN4O8S and a molecular weight of 800.13 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-[[(1S)-2-(4-bromophenyl)-1-[(4-chloro-3-nitrophenyl)sulfonylamino]ethyl]carbamoyl]-4-(4-phenylphenoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-[[(1S)-2-(4-bromophenyl)-1-[(4-chloro-3-nitrophenyl)sulfonylamino]ethyl]carbamoyl]-4-(4-phenylphenoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 132563040 |
| Molecular Formula | C36H36BrClN4O8S |
| Molecular Weight | 800.13 g/mol |
| Exact Mass | 798.11 |
| IUPAC Name | tert-butyl (2S,4S)-2-[[(1S)-2-(4-bromophenyl)-1-[(4-chloro-3-nitrophenyl)sulfonylamino]ethyl]carbamoyl]-4-(4-phenylphenoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](Oc2ccc(-c3ccccc3)cc2)C[C@H]1C(=O)N[C@H](Cc1ccc(Br)cc1)NS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H36BrClN4O8S/c1-36(2,3)50-35(44)41-22-28(49-27-15-11-25(12-16-27)24-7-5-4-6-8-24)20-32(41)34(43)39-33(19-23-9-13-26(37)14-10-23)40-51(47,48)29-17-18-30(38)31(21-29)42(45)46/h4-18,21,28,32-33,40H,19-20,22H2,1-3H3,(H,39,43)/t28-,32-,33-/m0/s1 |
| InChIKey | JKYZXQOFHBDJSQ-RMFXYIPJSA-N |
| XLogP | 7.10 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.13 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|