C16H16N2O3 — CID 132563470
methyl 2-[hydroxy-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]methyl]prop-2-enoate (PubChem CID 132563470) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is methyl 2-[hydroxy-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]methyl]prop-2-enoate.
| Compound Name | methyl 2-[hydroxy-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 132563470 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | methyl 2-[hydroxy-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(O)c1ccnc(-c2cc(C)ccn2)c1 |
| InChI | InChI=1S/C16H16N2O3/c1-10-4-6-17-13(8-10)14-9-12(5-7-18-14)15(19)11(2)16(20)21-3/h4-9,15,19H,2H2,1,3H3 |
| InChIKey | UITQHPMCUHOFAL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|