C50H72N2O4 — CID 132565557
4-(3,5-diheptoxyphenyl)-2-[4-(3,5-diheptoxyphenyl)-2-pyridinyl]pyridine (PubChem CID 132565557) has the molecular formula C50H72N2O4 and a molecular weight of 765.14 g/mol. Its IUPAC name is 4-(3,5-diheptoxyphenyl)-2-[4-(3,5-diheptoxyphenyl)-2-pyridinyl]pyridine.
| Compound Name | 4-(3,5-diheptoxyphenyl)-2-[4-(3,5-diheptoxyphenyl)-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 132565557 |
| Molecular Formula | C50H72N2O4 |
| Molecular Weight | 765.14 g/mol |
| Exact Mass | 764.55 |
| IUPAC Name | 4-(3,5-diheptoxyphenyl)-2-[4-(3,5-diheptoxyphenyl)-2-pyridinyl]pyridine |
| SMILES | CCCCCCCOc1cc(OCCCCCCC)cc(-c2ccnc(-c3cc(-c4cc(OCCCCCCC)cc(OCCCCCCC)c4)ccn3)c2)c1 |
| InChI | InChI=1S/C50H72N2O4/c1-5-9-13-17-21-29-53-45-33-43(34-46(39-45)54-30-22-18-14-10-6-2)41-25-27-51-49(37-41)50-38-42(26-28-52-50)44-35-47(55-31-23-19-15-11-7-3)40-48(36-44)56-32-24-20-16-12-8-4/h25-28,33-40H,5-24,29-32H2,1-4H3 |
| InChIKey | APJVWWFFYDVCSP-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.14 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|