C49H58N2+2 — CID 132565587
[4-[[4-[(9,9-dihexylfluoren-2-yl)-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 132565587) has the molecular formula C49H58N2+2 and a molecular weight of 675.02 g/mol. Its IUPAC name is [4-[[4-[(9,9-dihexylfluoren-2-yl)-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[[4-[(9,9-dihexylfluoren-2-yl)-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 132565587 |
| Molecular Formula | C49H58N2+2 |
| Molecular Weight | 675.02 g/mol |
| Exact Mass | 674.46 |
| IUPAC Name | [4-[[4-[(9,9-dihexylfluoren-2-yl)-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CCCCCCC1(CCCCCC)c2ccccc2-c2ccc(C(=C3C=CC(=[N+](C)C)C=C3)c3ccc(C=C4C=CC(=[N+](C)C)C=C4)cc3)cc21 |
| InChI | InChI=1S/C49H58N2/c1-7-9-11-15-33-49(34-16-12-10-8-2)46-18-14-13-17-44(46)45-32-27-41(36-47(45)49)48(40-25-30-43(31-26-40)51(5)6)39-23-19-37(20-24-39)35-38-21-28-42(29-22-38)50(3)4/h13-14,17-32,35-36H,7-12,15-16,33-34H2,1-6H3/q+2 |
| InChIKey | DAIDRUCNUITCOK-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.02 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|