C15H15F3N2O2S — CID 132566799
(2R)-1,1,1-trifluoro-3-nitro-2-phenyl-N-(2-thiophen-2-ylethyl)propan-2-amine (PubChem CID 132566799) has the molecular formula C15H15F3N2O2S and a molecular weight of 344.36 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-nitro-2-phenyl-N-(2-thiophen-2-ylethyl)propan-2-amine.
| Compound Name | (2R)-1,1,1-trifluoro-3-nitro-2-phenyl-N-(2-thiophen-2-ylethyl)propan-2-amine |
|---|---|
| PubChem CID | 132566799 |
| Molecular Formula | C15H15F3N2O2S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-nitro-2-phenyl-N-(2-thiophen-2-ylethyl)propan-2-amine |
| SMILES | O=[N+]([O-])C[C@](NCCc1cccs1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H15F3N2O2S/c16-15(17,18)14(11-20(21)22,12-5-2-1-3-6-12)19-9-8-13-7-4-10-23-13/h1-7,10,19H,8-9,11H2/t14-/m0/s1 |
| InChIKey | MWVCRJKQHBYWNZ-AWEZNQCLSA-N |
| XLogP | 3.61 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|