C14H20O2 — CID 132566880
(5S,6R,6aS)-5-ethenyl-6-(methoxymethyl)-2,6a-dimethyl-3a,4,5,6-tetrahydropentalen-1-one (PubChem CID 132566880) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (5S,6R,6aS)-5-ethenyl-6-(methoxymethyl)-2,6a-dimethyl-3a,4,5,6-tetrahydropentalen-1-one.
| Compound Name | (5S,6R,6aS)-5-ethenyl-6-(methoxymethyl)-2,6a-dimethyl-3a,4,5,6-tetrahydropentalen-1-one |
|---|---|
| PubChem CID | 132566880 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (5S,6R,6aS)-5-ethenyl-6-(methoxymethyl)-2,6a-dimethyl-3a,4,5,6-tetrahydropentalen-1-one |
| SMILES | C=C[C@@H]1CC2C=C(C)C(=O)[C@]2(C)[C@@H]1COC |
| InChI | InChI=1S/C14H20O2/c1-5-10-7-11-6-9(2)13(15)14(11,3)12(10)8-16-4/h5-6,10-12H,1,7-8H2,2-4H3/t10-,11?,12-,14+/m1/s1 |
| InChIKey | APBOSCBQSUOYOT-JSTGXOHRSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|