C14H20O5 — CID 132567590
dimethyl (3S,3aR,7aS)-3-methyl-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate (PubChem CID 132567590) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is dimethyl (3S,3aR,7aS)-3-methyl-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate.
| Compound Name | dimethyl (3S,3aR,7aS)-3-methyl-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 132567590 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | dimethyl (3S,3aR,7aS)-3-methyl-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](C)[C@H]2C(=O)CCC[C@@H]21 |
| InChI | InChI=1S/C14H20O5/c1-8-7-14(12(16)18-2,13(17)19-3)9-5-4-6-10(15)11(8)9/h8-9,11H,4-7H2,1-3H3/t8-,9-,11+/m0/s1 |
| InChIKey | KSBRXQRRIZOVSY-ATZCPNFKSA-N |
| XLogP | 1.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|