C49H44N4O5 — CID 132567977
(4R,5R,15R,16R)-10-pent-4-enoxy-4,5,15,16-tetraphenyl-3,6,14,17-tetrazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone (PubChem CID 132567977) has the molecular formula C49H44N4O5 and a molecular weight of 768.91 g/mol. Its IUPAC name is (4R,5R,15R,16R)-10-pent-4-enoxy-4,5,15,16-tetraphenyl-3,6,14,17-tetrazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone.
| Compound Name | (4R,5R,15R,16R)-10-pent-4-enoxy-4,5,15,16-tetraphenyl-3,6,14,17-tetrazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone |
|---|---|
| PubChem CID | 132567977 |
| Molecular Formula | C49H44N4O5 |
| Molecular Weight | 768.91 g/mol |
| Exact Mass | 768.33 |
| IUPAC Name | (4R,5R,15R,16R)-10-pent-4-enoxy-4,5,15,16-tetraphenyl-3,6,14,17-tetrazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone |
| SMILES | C=CCCCOc1cc2cc(c1)C(=O)N[C@H](c1ccccc1)[C@@H](c1ccccc1)NC(=O)c1cccc(c1)C(=O)N[C@H](c1ccccc1)[C@@H](c1ccccc1)NC2=O |
| InChI | InChI=1S/C49H44N4O5/c1-2-3-16-28-58-41-31-39-30-40(32-41)49(57)53-45(36-24-14-7-15-25-36)43(34-20-10-5-11-21-34)51-47(55)38-27-17-26-37(29-38)46(54)50-42(33-18-8-4-9-19-33)44(52-48(39)56)35-22-12-6-13-23-35/h2,4-15,17-27,29-32,42-45H,1,3,16,28H2,(H,50,54)(H,51,55)(H,52,56)(H,53,57)/t42-,43-,44-,45-/m1/s1 |
| InChIKey | WPNNDRFRTUTDJY-XISJIPAJSA-N |
| XLogP | 8.63 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.91 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|