C15H17NO — CID 132571149
6-quinolin-8-ylhexan-3-one (PubChem CID 132571149) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 6-quinolin-8-ylhexan-3-one.
| Compound Name | 6-quinolin-8-ylhexan-3-one |
|---|---|
| PubChem CID | 132571149 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 6-quinolin-8-ylhexan-3-one |
| SMILES | CCC(=O)CCCc1cccc2cccnc12 |
| InChI | InChI=1S/C15H17NO/c1-2-14(17)10-4-8-12-6-3-7-13-9-5-11-16-15(12)13/h3,5-7,9,11H,2,4,8,10H2,1H3 |
| InChIKey | OSDNFGWTGZMMET-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |