C17H20N2O2 — CID 103258780
(Z)-2-ethyl-4-(2-quinolin-8-ylethylamino)but-2-enoic acid (PubChem CID 103258780) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is (Z)-2-ethyl-4-(2-quinolin-8-ylethylamino)but-2-enoic acid.
| Compound Name | (Z)-2-ethyl-4-(2-quinolin-8-ylethylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 103258780 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (Z)-2-ethyl-4-(2-quinolin-8-ylethylamino)but-2-enoic acid |
| SMILES | CC/C(=C/CNCCc1cccc2cccnc12)C(=O)O |
| InChI | InChI=1S/C17H20N2O2/c1-2-13(17(20)21)8-11-18-12-9-15-6-3-5-14-7-4-10-19-16(14)15/h3-8,10,18H,2,9,11-12H2,1H3,(H,20,21)/b13-8- |
| InChIKey | XAMOMTNWSFCONO-JYRVWZFOSA-N |
| XLogP | 2.79 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|