C16H22N2O2S — CID 81426941
3-ethylsulfonyl-N-(2-quinolin-8-ylethyl)propan-1-amine (PubChem CID 81426941) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 3-ethylsulfonyl-N-(2-quinolin-8-ylethyl)propan-1-amine.
| Compound Name | 3-ethylsulfonyl-N-(2-quinolin-8-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 81426941 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-ethylsulfonyl-N-(2-quinolin-8-ylethyl)propan-1-amine |
| SMILES | CCS(=O)(=O)CCCNCCc1cccc2cccnc12 |
| InChI | InChI=1S/C16H22N2O2S/c1-2-21(19,20)13-5-10-17-12-9-15-7-3-6-14-8-4-11-18-16(14)15/h3-4,6-8,11,17H,2,5,9-10,12-13H2,1H3 |
| InChIKey | GMLMWAMZWMNXIL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|