C17H18N2S — CID 78870691
N-[(3-methylthiophen-2-yl)methyl]-2-quinolin-8-ylethanamine (PubChem CID 78870691) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is N-[(3-methylthiophen-2-yl)methyl]-2-quinolin-8-ylethanamine.
| Compound Name | N-[(3-methylthiophen-2-yl)methyl]-2-quinolin-8-ylethanamine |
|---|---|
| PubChem CID | 78870691 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-[(3-methylthiophen-2-yl)methyl]-2-quinolin-8-ylethanamine |
| SMILES | Cc1ccsc1CNCCc1cccc2cccnc12 |
| InChI | InChI=1S/C17H18N2S/c1-13-8-11-20-16(13)12-18-10-7-15-5-2-4-14-6-3-9-19-17(14)15/h2-6,8-9,11,18H,7,10,12H2,1H3 |
| InChIKey | KWDVIFWWJFRBDC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|