C13H13N3O2 — CID 132572192
11-methyl-9,11,13-triazatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12-dione (PubChem CID 132572192) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 11-methyl-9,11,13-triazatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12-dione.
| Compound Name | 11-methyl-9,11,13-triazatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 132572192 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 11-methyl-9,11,13-triazatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C1CCC2c2ccccc21 |
| InChI | InChI=1S/C13H13N3O2/c1-14-12(17)15-10-6-7-11(16(15)13(14)18)9-5-3-2-4-8(9)10/h2-5,10-11H,6-7H2,1H3 |
| InChIKey | XSGUZUCUWPQRMZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |