C17H13N3O2 — CID 2802753
17-methyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 2802753) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 17-methyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 17-methyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 2802753 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 17-methyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C17H13N3O2/c1-18-16(21)19-14-10-6-2-3-7-11(10)15(20(19)17(18)22)13-9-5-4-8-12(13)14/h2-9,14-15H,1H3 |
| InChIKey | JAXWLJXTMJVDGW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |