C15H12FNS — CID 132573175
2-(4-fluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazole (PubChem CID 132573175) has the molecular formula C15H12FNS and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-(4-fluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 132573175 |
| Molecular Formula | C15H12FNS |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-(4-fluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazole |
| SMILES | Fc1ccc(C2=NCC(c3ccccc3)S2)cc1 |
| InChI | InChI=1S/C15H12FNS/c16-13-8-6-12(7-9-13)15-17-10-14(18-15)11-4-2-1-3-5-11/h1-9,14H,10H2 |
| InChIKey | XUFMOAPLBVPWTB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |