C21H14N2S — CID 132573446
2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole (PubChem CID 132573446) has the molecular formula C21H14N2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole.
| Compound Name | 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 132573446 |
| Molecular Formula | C21H14N2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole |
| SMILES | c1ccc(-c2cc(-c3cccs3)c3[nH]c4ccccc4c3n2)cc1 |
| InChI | InChI=1S/C21H14N2S/c1-2-7-14(8-3-1)18-13-16(19-11-6-12-24-19)21-20(23-18)15-9-4-5-10-17(15)22-21/h1-13,22H |
| InChIKey | HMAUZOGORGIPGV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |