About 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole
2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole (PubChem CID 132573446) has the molecular formula C21H14N2S
and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole.
Molecular Properties
| Compound Name | 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole |
| PubChem CID | 132573446 |
| Molecular Formula | C21H14N2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole |
| SMILES | c1ccc(-c2cc(-c3cccs3)c3[nH]c4ccccc4c3n2)cc1 |
| InChI | InChI=1S/C21H14N2S/c1-2-7-14(8-3-1)18-13-16(19-11-6-12-24-19)21-20(23-18)15-9-4-5-10-17(15)22-21/h1-13,22H |
| InChIKey | HMAUZOGORGIPGV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole?
The IUPAC name of 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole (CID 132573446) is 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole.
What is the SMILES notation for 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole?
The canonical SMILES for 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole is c1ccc(-c2cc(-c3cccs3)c3[nH]c4ccccc4c3n2)cc1.
What is the InChIKey of 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole?
The InChIKey is HMAUZOGORGIPGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N2S/c1-2-7-14(8-3-1)18-13-16(19-11-6-12-24-19)21-20(23-18)15-9-4-5-10-17(15)22-21/h1-13,22H.
What are the key properties of 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole?
2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole has a molecular weight of 326.42 g/mol, XLogP of 6.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4-thiophen-2-yl-5H-pyrido[3,2-b]indole is sourced from PubChem (CID 132573446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).