C30H27N3OS2 — CID 132574356
N-[2-(1-methylbenzimidazol-2-yl)propan-2-yl]-2,6-bis(phenylsulfanyl)benzamide (PubChem CID 132574356) has the molecular formula C30H27N3OS2 and a molecular weight of 509.70 g/mol. Its IUPAC name is N-[2-(1-methylbenzimidazol-2-yl)propan-2-yl]-2,6-bis(phenylsulfanyl)benzamide.
| Compound Name | N-[2-(1-methylbenzimidazol-2-yl)propan-2-yl]-2,6-bis(phenylsulfanyl)benzamide |
|---|---|
| PubChem CID | 132574356 |
| Molecular Formula | C30H27N3OS2 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[2-(1-methylbenzimidazol-2-yl)propan-2-yl]-2,6-bis(phenylsulfanyl)benzamide |
| SMILES | Cn1c(C(C)(C)NC(=O)c2c(Sc3ccccc3)cccc2Sc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C30H27N3OS2/c1-30(2,29-31-23-17-10-11-18-24(23)33(29)3)32-28(34)27-25(35-21-13-6-4-7-14-21)19-12-20-26(27)36-22-15-8-5-9-16-22/h4-20H,1-3H3,(H,32,34) |
| InChIKey | HOZALEBMSGGPIN-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |