C23H25N3OS — CID 132574362
N-[2-(1-methylbenzimidazol-2-yl)propan-2-yl]-2-phenylsulfanylcyclopentene-1-carboxamide (PubChem CID 132574362) has the molecular formula C23H25N3OS and a molecular weight of 391.54 g/mol. Its IUPAC name is N-[2-(1-methylbenzimidazol-2-yl)propan-2-yl]-2-phenylsulfanylcyclopentene-1-carboxamide.
| Compound Name | N-[2-(1-methylbenzimidazol-2-yl)propan-2-yl]-2-phenylsulfanylcyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 132574362 |
| Molecular Formula | C23H25N3OS |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[2-(1-methylbenzimidazol-2-yl)propan-2-yl]-2-phenylsulfanylcyclopentene-1-carboxamide |
| SMILES | Cn1c(C(C)(C)NC(=O)C2=C(Sc3ccccc3)CCC2)nc2ccccc21 |
| InChI | InChI=1S/C23H25N3OS/c1-23(2,22-24-18-13-7-8-14-19(18)26(22)3)25-21(27)17-12-9-15-20(17)28-16-10-5-4-6-11-16/h4-8,10-11,13-14H,9,12,15H2,1-3H3,(H,25,27) |
| InChIKey | JAWYOFFOGCWPLM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |