C19H24O5 — CID 132578734
(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(E)-2-phenylethenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 132578734) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(E)-2-phenylethenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(E)-2-phenylethenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 132578734 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(E)-2-phenylethenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](/C=C/c1ccccc1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C19H24O5/c1-18(2)21-14-13(11-10-12-8-6-5-7-9-12)20-17-16(15(14)22-18)23-19(3,4)24-17/h5-11,13-17H,1-4H3/b11-10+/t13-,14+,15+,16-,17-/m1/s1 |
| InChIKey | NBKDJVHEVQTVLS-KUPMKIAMSA-N |
| XLogP | 3.10 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |