C16H18O5 — CID 132579552
[(2E,4Z)-6-acetyloxy-2-(hydroxymethyl)hexa-2,4-dienyl] benzoate (PubChem CID 132579552) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is [(2E,4Z)-6-acetyloxy-2-(hydroxymethyl)hexa-2,4-dienyl] benzoate.
| Compound Name | [(2E,4Z)-6-acetyloxy-2-(hydroxymethyl)hexa-2,4-dienyl] benzoate |
|---|---|
| PubChem CID | 132579552 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [(2E,4Z)-6-acetyloxy-2-(hydroxymethyl)hexa-2,4-dienyl] benzoate |
| SMILES | CC(=O)OC/C=C\C=C(/CO)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18O5/c1-13(18)20-10-6-5-7-14(11-17)12-21-16(19)15-8-3-2-4-9-15/h2-9,17H,10-12H2,1H3/b6-5-,14-7+ |
| InChIKey | HQCSTAYBCFGZFV-NTBKVEBNSA-N |
| XLogP | 1.88 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|