C14H16FNO3 — CID 132581445
methyl N-[1-(4-fluoro-2-prop-2-enoxyphenyl)prop-2-enyl]carbamate (PubChem CID 132581445) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is methyl N-[1-(4-fluoro-2-prop-2-enoxyphenyl)prop-2-enyl]carbamate.
| Compound Name | methyl N-[1-(4-fluoro-2-prop-2-enoxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 132581445 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | methyl N-[1-(4-fluoro-2-prop-2-enoxyphenyl)prop-2-enyl]carbamate |
| SMILES | C=CCOc1cc(F)ccc1C(C=C)NC(=O)OC |
| InChI | InChI=1S/C14H16FNO3/c1-4-8-19-13-9-10(15)6-7-11(13)12(5-2)16-14(17)18-3/h4-7,9,12H,1-2,8H2,3H3,(H,16,17) |
| InChIKey | YPLQQLKCVUAUIH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|