C13H18FNO3 — CID 63066050
methyl 2-[2-[1-(ethylamino)ethyl]-5-fluorophenoxy]acetate (PubChem CID 63066050) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is methyl 2-[2-[1-(ethylamino)ethyl]-5-fluorophenoxy]acetate.
| Compound Name | methyl 2-[2-[1-(ethylamino)ethyl]-5-fluorophenoxy]acetate |
|---|---|
| PubChem CID | 63066050 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | methyl 2-[2-[1-(ethylamino)ethyl]-5-fluorophenoxy]acetate |
| SMILES | CCNC(C)c1ccc(F)cc1OCC(=O)OC |
| InChI | InChI=1S/C13H18FNO3/c1-4-15-9(2)11-6-5-10(14)7-12(11)18-8-13(16)17-3/h5-7,9,15H,4,8H2,1-3H3 |
| InChIKey | OPEZEZQKRWSNSW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |