C16H23FN2O2 — CID 63066220
N-cyclopropyl-2-[2-[1-(ethylamino)ethyl]-5-fluorophenoxy]propanamide (PubChem CID 63066220) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is N-cyclopropyl-2-[2-[1-(ethylamino)ethyl]-5-fluorophenoxy]propanamide.
| Compound Name | N-cyclopropyl-2-[2-[1-(ethylamino)ethyl]-5-fluorophenoxy]propanamide |
|---|---|
| PubChem CID | 63066220 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-cyclopropyl-2-[2-[1-(ethylamino)ethyl]-5-fluorophenoxy]propanamide |
| SMILES | CCNC(C)c1ccc(F)cc1OC(C)C(=O)NC1CC1 |
| InChI | InChI=1S/C16H23FN2O2/c1-4-18-10(2)14-8-5-12(17)9-15(14)21-11(3)16(20)19-13-6-7-13/h5,8-11,13,18H,4,6-7H2,1-3H3,(H,19,20) |
| InChIKey | DFSGPJOKNRHSGK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |