C14H14F4N2O4 — CID 132581606
2,2,3,3-tetrafluoro-4-hydroxy-4-(4-nitrophenyl)-1-pyrrolidin-1-ylbutan-1-one (PubChem CID 132581606) has the molecular formula C14H14F4N2O4 and a molecular weight of 350.27 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-hydroxy-4-(4-nitrophenyl)-1-pyrrolidin-1-ylbutan-1-one.
| Compound Name | 2,2,3,3-tetrafluoro-4-hydroxy-4-(4-nitrophenyl)-1-pyrrolidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 132581606 |
| Molecular Formula | C14H14F4N2O4 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-hydroxy-4-(4-nitrophenyl)-1-pyrrolidin-1-ylbutan-1-one |
| SMILES | O=C(N1CCCC1)C(F)(F)C(F)(F)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H14F4N2O4/c15-13(16,14(17,18)12(22)19-7-1-2-8-19)11(21)9-3-5-10(6-4-9)20(23)24/h3-6,11,21H,1-2,7-8H2 |
| InChIKey | CRPOXBYRWVLTFL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|