C13H12BrF2NO4 — CID 132585763
1-[3-(4-bromo-2,6-difluorophenoxy)-2-hydroxypropyl]pyrrolidine-2,5-dione (PubChem CID 132585763) has the molecular formula C13H12BrF2NO4 and a molecular weight of 364.14 g/mol. Its IUPAC name is 1-[3-(4-bromo-2,6-difluorophenoxy)-2-hydroxypropyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-(4-bromo-2,6-difluorophenoxy)-2-hydroxypropyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 132585763 |
| Molecular Formula | C13H12BrF2NO4 |
| Molecular Weight | 364.14 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 1-[3-(4-bromo-2,6-difluorophenoxy)-2-hydroxypropyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CC(O)COc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C13H12BrF2NO4/c14-7-3-9(15)13(10(16)4-7)21-6-8(18)5-17-11(19)1-2-12(17)20/h3-4,8,18H,1-2,5-6H2 |
| InChIKey | HTKLIKKZDGSOLR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.14 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|