C17H23NO4 — CID 132585786
1-[2-hydroxy-3-(3-methyl-4-propan-2-ylphenoxy)propyl]pyrrolidine-2,5-dione (PubChem CID 132585786) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(3-methyl-4-propan-2-ylphenoxy)propyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-hydroxy-3-(3-methyl-4-propan-2-ylphenoxy)propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 132585786 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1-[2-hydroxy-3-(3-methyl-4-propan-2-ylphenoxy)propyl]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(OCC(O)CN2C(=O)CCC2=O)ccc1C(C)C |
| InChI | InChI=1S/C17H23NO4/c1-11(2)15-5-4-14(8-12(15)3)22-10-13(19)9-18-16(20)6-7-17(18)21/h4-5,8,11,13,19H,6-7,9-10H2,1-3H3 |
| InChIKey | PQMFWOUUFDDODW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|