C7H11FN4O — CID 132586573
4-amino-1-(2-fluoroethyl)-N-methylpyrazole-3-carboxamide (PubChem CID 132586573) has the molecular formula C7H11FN4O and a molecular weight of 186.19 g/mol. Its IUPAC name is 4-amino-1-(2-fluoroethyl)-N-methylpyrazole-3-carboxamide.
| Compound Name | 4-amino-1-(2-fluoroethyl)-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 132586573 |
| Molecular Formula | C7H11FN4O |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-amino-1-(2-fluoroethyl)-N-methylpyrazole-3-carboxamide |
| SMILES | CNC(=O)c1nn(CCF)cc1N |
| InChI | InChI=1S/C7H11FN4O/c1-10-7(13)6-5(9)4-12(11-6)3-2-8/h4H,2-3,9H2,1H3,(H,10,13) |
| InChIKey | UEYJPCGKDRSSAX-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |