C8H13N5O2 — CID 107345223
4-amino-1-[3-(methylamino)-3-oxopropyl]pyrazole-3-carboxamide (PubChem CID 107345223) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-amino-1-[3-(methylamino)-3-oxopropyl]pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-[3-(methylamino)-3-oxopropyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107345223 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 4-amino-1-[3-(methylamino)-3-oxopropyl]pyrazole-3-carboxamide |
| SMILES | CNC(=O)CCn1cc(N)c(C(N)=O)n1 |
| InChI | InChI=1S/C8H13N5O2/c1-11-6(14)2-3-13-4-5(9)7(12-13)8(10)15/h4H,2-3,9H2,1H3,(H2,10,15)(H,11,14) |
| InChIKey | AEXJNHRFIYYKQU-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |