C7H10N8O — CID 107345303
4-amino-1-[(2-methyltetrazol-5-yl)methyl]pyrazole-3-carboxamide (PubChem CID 107345303) has the molecular formula C7H10N8O and a molecular weight of 222.21 g/mol. Its IUPAC name is 4-amino-1-[(2-methyltetrazol-5-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-[(2-methyltetrazol-5-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107345303 |
| Molecular Formula | C7H10N8O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4-amino-1-[(2-methyltetrazol-5-yl)methyl]pyrazole-3-carboxamide |
| SMILES | Cn1nnc(Cn2cc(N)c(C(N)=O)n2)n1 |
| InChI | InChI=1S/C7H10N8O/c1-14-11-5(10-13-14)3-15-2-4(8)6(12-15)7(9)16/h2H,3,8H2,1H3,(H2,9,16) |
| InChIKey | DXOYMWLPNIVQAC-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 130.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |