C8H14N4O3 — CID 107345439
4-amino-1-[2-(2-hydroxyethoxy)ethyl]pyrazole-3-carboxamide (PubChem CID 107345439) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-amino-1-[2-(2-hydroxyethoxy)ethyl]pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-[2-(2-hydroxyethoxy)ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107345439 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 4-amino-1-[2-(2-hydroxyethoxy)ethyl]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CCOCCO)cc1N |
| InChI | InChI=1S/C8H14N4O3/c9-6-5-12(1-3-15-4-2-13)11-7(6)8(10)14/h5,13H,1-4,9H2,(H2,10,14) |
| InChIKey | KEZMZCRFGXDGKS-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|