C6H12N4O2 — CID 61070904
2-[2-(3-amino-1,2,4-triazol-1-yl)ethoxy]ethanol (PubChem CID 61070904) has the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-[2-(3-amino-1,2,4-triazol-1-yl)ethoxy]ethanol.
| Compound Name | 2-[2-(3-amino-1,2,4-triazol-1-yl)ethoxy]ethanol |
|---|---|
| PubChem CID | 61070904 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-[2-(3-amino-1,2,4-triazol-1-yl)ethoxy]ethanol |
| SMILES | Nc1ncn(CCOCCO)n1 |
| InChI | InChI=1S/C6H12N4O2/c7-6-8-5-10(9-6)1-3-12-4-2-11/h5,11H,1-4H2,(H2,7,9) |
| InChIKey | SUPDQGFMKOTBIC-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|